C19H17ClN6O4 — CID 110338553
N-[(E)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide (PubChem CID 110338553) has the molecular formula C19H17ClN6O4 and a molecular weight of 428.84 g/mol. Its IUPAC name is N-[(E)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide.
| Compound Name | N-[(E)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 110338553 |
| Molecular Formula | C19H17ClN6O4 |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[(E)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide |
| SMILES | O=C(CNc1n[nH]c(=O)[nH]c1=O)N/N=C/c1ccccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C19H17ClN6O4/c20-14-7-3-1-6-13(14)11-30-15-8-4-2-5-12(15)9-22-24-16(27)10-21-17-18(28)23-19(29)26-25-17/h1-9H,10-11H2,(H,21,25)(H,24,27)(H2,23,26,28,29)/b22-9+ |
| InChIKey | CXHPTZYOLLPIBP-LSFURLLWSA-N |
| XLogP | 1.25 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|