About (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine
(E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine (PubChem CID 11033901) has the molecular formula C14H33NSi3
and a molecular weight of 299.68 g/mol. Its IUPAC name is (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine.
Molecular Properties
| Compound Name | (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine |
| PubChem CID | 11033901 |
| Molecular Formula | C14H33NSi3 |
| Molecular Weight | 299.68 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine |
| SMILES | CC(/N=C/C=C/[Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H33NSi3/c1-14(17(5,6)7,18(8,9)10)15-12-11-13-16(2,3)4/h11-13H,1-10H3/b13-11+,15-12+ |
| InChIKey | KXCXAKIDWRLWCJ-CEHLPYKYSA-N |
| XLogP | 5.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine?
The IUPAC name of (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine (CID 11033901) is (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine.
What is the SMILES notation for (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine?
The canonical SMILES for (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine is CC(/N=C/C=C/[Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine?
The InChIKey is KXCXAKIDWRLWCJ-CEHLPYKYSA-N. The full InChI is InChI=1S/C14H33NSi3/c1-14(17(5,6)7,18(8,9)10)15-12-11-13-16(2,3)4/h11-13H,1-10H3/b13-11+,15-12+.
What are the key properties of (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine?
(E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine has a molecular weight of 299.68 g/mol, XLogP of 5.00, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,E)-N-[1,1-bis(trimethylsilyl)ethyl]-3-trimethylsilylprop-2-en-1-imine is sourced from PubChem (CID 11033901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).