About (pentafluoro-λ6-tellanyl)benzene
(pentafluoro-λ6-tellanyl)benzene (PubChem CID 11033902) has the molecular formula C6H5F5Te
and a molecular weight of 299.70 g/mol. Its IUPAC name is (pentafluoro-λ6-tellanyl)benzene.
Molecular Properties
| Compound Name | (pentafluoro-λ6-tellanyl)benzene |
| PubChem CID | 11033902 |
| Molecular Formula | C6H5F5Te |
| Molecular Weight | 299.70 g/mol |
| Exact Mass | 301.94 |
| IUPAC Name | (pentafluoro-λ6-tellanyl)benzene |
| SMILES | F[Te](F)(F)(F)(F)c1ccccc1 |
| InChI | InChI=1S/C6H5F5Te/c7-12(8,9,10,11)6-4-2-1-3-5-6/h1-5H |
| InChIKey | DPBODMLIWDPOTJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.70 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (pentafluoro-λ6-tellanyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (pentafluoro-λ6-tellanyl)benzene?
The IUPAC name of (pentafluoro-λ6-tellanyl)benzene (CID 11033902) is (pentafluoro-λ6-tellanyl)benzene.
What is the SMILES notation for (pentafluoro-λ6-tellanyl)benzene?
The canonical SMILES for (pentafluoro-λ6-tellanyl)benzene is F[Te](F)(F)(F)(F)c1ccccc1.
What is the InChIKey of (pentafluoro-λ6-tellanyl)benzene?
The InChIKey is DPBODMLIWDPOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F5Te/c7-12(8,9,10,11)6-4-2-1-3-5-6/h1-5H.
What are the key properties of (pentafluoro-λ6-tellanyl)benzene?
(pentafluoro-λ6-tellanyl)benzene has a molecular weight of 299.70 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (pentafluoro-λ6-tellanyl)benzene is sourced from PubChem (CID 11033902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).