C14H24O5Si — CID 11033926
[(2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-2,3-dihydropyran-3-yl] acetate (PubChem CID 11033926) has the molecular formula C14H24O5Si and a molecular weight of 300.43 g/mol. Its IUPAC name is [(2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-2,3-dihydropyran-3-yl] acetate.
| Compound Name | [(2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-2,3-dihydropyran-3-yl] acetate |
|---|---|
| PubChem CID | 11033926 |
| Molecular Formula | C14H24O5Si |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [(2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-2,3-dihydropyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(=O)C=CO[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H24O5Si/c1-10(15)19-13-11(16)7-8-17-12(13)9-18-20(5,6)14(2,3)4/h7-8,12-13H,9H2,1-6H3/t12-,13+/m1/s1 |
| InChIKey | GHQYUTSWCKLCDH-OLZOCXBDSA-N |
| XLogP | 2.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|