C15H30O4Si — CID 11034008
(5S)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-hydroxy-3,5-dimethyloxolan-2-one (PubChem CID 11034008) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is (5S)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-hydroxy-3,5-dimethyloxolan-2-one.
| Compound Name | (5S)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-hydroxy-3,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 11034008 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (5S)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-hydroxy-3,5-dimethyloxolan-2-one |
| SMILES | CC1C(=O)O[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)C1O |
| InChI | InChI=1S/C15H30O4Si/c1-11-12(16)15(5,19-13(11)17)9-8-10-18-20(6,7)14(2,3)4/h11-12,16H,8-10H2,1-7H3/t11?,12?,15-/m0/s1 |
| InChIKey | JNSNXJHYPPJQRF-QOZQQMKHSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|