C18H15F3O — CID 11034039
2,2,2-trifluoro-1-(1,4,6-trimethyl-9H-fluoren-9-yl)ethanone (PubChem CID 11034039) has the molecular formula C18H15F3O and a molecular weight of 304.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(1,4,6-trimethyl-9H-fluoren-9-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(1,4,6-trimethyl-9H-fluoren-9-yl)ethanone |
|---|---|
| PubChem CID | 11034039 |
| Molecular Formula | C18H15F3O |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2,2,2-trifluoro-1-(1,4,6-trimethyl-9H-fluoren-9-yl)ethanone |
| SMILES | Cc1ccc2c(c1)-c1c(C)ccc(C)c1C2C(=O)C(F)(F)F |
| InChI | InChI=1S/C18H15F3O/c1-9-4-7-12-13(8-9)14-10(2)5-6-11(3)15(14)16(12)17(22)18(19,20)21/h4-8,16H,1-3H3 |
| InChIKey | YJRGWHCZYSBACM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |