C15H14ClFN2O — CID 110340711
N-[(E)-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]methanamine (PubChem CID 110340711) has the molecular formula C15H14ClFN2O and a molecular weight of 292.74 g/mol. Its IUPAC name is N-[(E)-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]methanamine.
| Compound Name | N-[(E)-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]methanamine |
|---|---|
| PubChem CID | 110340711 |
| Molecular Formula | C15H14ClFN2O |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | N-[(E)-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]methanamine |
| SMILES | CN/N=C/c1cccc(OCc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C15H14ClFN2O/c1-18-19-9-11-4-2-5-12(8-11)20-10-13-14(16)6-3-7-15(13)17/h2-9,18H,10H2,1H3/b19-9+ |
| InChIKey | VVCWDEZJWGHKIW-DJKKODMXSA-N |
| XLogP | 3.61 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|