C17H24O5 — CID 11034190
(1S,2S,6S,11S,15S)-4,4,14,14,15-pentamethyl-3,5,10-trioxatetracyclo[6.6.1.02,6.011,15]pentadecane-7,9-dione (PubChem CID 11034190) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (1S,2S,6S,11S,15S)-4,4,14,14,15-pentamethyl-3,5,10-trioxatetracyclo[6.6.1.02,6.011,15]pentadecane-7,9-dione.
| Compound Name | (1S,2S,6S,11S,15S)-4,4,14,14,15-pentamethyl-3,5,10-trioxatetracyclo[6.6.1.02,6.011,15]pentadecane-7,9-dione |
|---|---|
| PubChem CID | 11034190 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (1S,2S,6S,11S,15S)-4,4,14,14,15-pentamethyl-3,5,10-trioxatetracyclo[6.6.1.02,6.011,15]pentadecane-7,9-dione |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C(=O)C1C(=O)O[C@H]3CCC(C)(C)[C@H]2[C@@]13C |
| InChI | InChI=1S/C17H24O5/c1-15(2)7-6-8-17(5)9(14(19)20-8)10(18)11-12(13(15)17)22-16(3,4)21-11/h8-9,11-13H,6-7H2,1-5H3/t8-,9?,11+,12+,13-,17+/m0/s1 |
| InChIKey | PQRXKKCNZFJLLL-CFWPZIEQSA-N |
| XLogP | 2.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|