C18H34O2Si — CID 11034272
(1S,2S,3aR,4R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-1,4-dimethyl-2,3,3a,5,6,8a-hexahydro-1H-azulen-4-ol (PubChem CID 11034272) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is (1S,2S,3aR,4R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-1,4-dimethyl-2,3,3a,5,6,8a-hexahydro-1H-azulen-4-ol.
| Compound Name | (1S,2S,3aR,4R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-1,4-dimethyl-2,3,3a,5,6,8a-hexahydro-1H-azulen-4-ol |
|---|---|
| PubChem CID | 11034272 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (1S,2S,3aR,4R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-1,4-dimethyl-2,3,3a,5,6,8a-hexahydro-1H-azulen-4-ol |
| SMILES | C[C@H]1[C@@H]2C=CCC[C@@](C)(O)[C@@H]2C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O2Si/c1-13-14-10-8-9-11-18(5,19)15(14)12-16(13)20-21(6,7)17(2,3)4/h8,10,13-16,19H,9,11-12H2,1-7H3/t13-,14-,15+,16-,18+/m0/s1 |
| InChIKey | WVUVQBDNDWAMQH-RNGZQALNSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|