C16H27NO5 — CID 11034344
tert-butyl (3aR,4S,6aS)-4-[(E)-4-hydroxybut-2-enyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 11034344) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is tert-butyl (3aR,4S,6aS)-4-[(E)-4-hydroxybut-2-enyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,4S,6aS)-4-[(E)-4-hydroxybut-2-enyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 11034344 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | tert-butyl (3aR,4S,6aS)-4-[(E)-4-hydroxybut-2-enyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1C/C=C/CO |
| InChI | InChI=1S/C16H27NO5/c1-15(2,3)22-14(19)17-10-12-13(21-16(4,5)20-12)11(17)8-6-7-9-18/h6-7,11-13,18H,8-10H2,1-5H3/b7-6+/t11-,12-,13+/m0/s1 |
| InChIKey | QZIPWMUXVGKDNN-PDSHNHIRSA-N |
| XLogP | 2.06 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|