About N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide
N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 110343829) has the molecular formula C10H13F3N2O2
and a molecular weight of 250.22 g/mol. Its IUPAC name is N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| PubChem CID | 110343829 |
| Molecular Formula | C10H13F3N2O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O2/c1-2-5-14-8(16)7-4-3-6-15(7)9(17)10(11,12)13/h2,7H,1,3-6H2,(H,14,16) |
| InChIKey | XJWINHVDZPBRNA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide?
The IUPAC name of N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (CID 110343829) is N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
What is the SMILES notation for N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide?
The canonical SMILES for N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide is C=CCNC(=O)C1CCCN1C(=O)C(F)(F)F.
What is the InChIKey of N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide?
The InChIKey is XJWINHVDZPBRNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N2O2/c1-2-5-14-8(16)7-4-3-6-15(7)9(17)10(11,12)13/h2,7H,1,3-6H2,(H,14,16).
What are the key properties of N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide?
N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide has a molecular weight of 250.22 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide is sourced from PubChem (CID 110343829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).