C21H32O2 — CID 11034444
[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] adamantane-2-carboxylate (PubChem CID 11034444) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] adamantane-2-carboxylate.
| Compound Name | [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 11034444 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] adamantane-2-carboxylate |
| SMILES | C[C@@H]1[C@@H](OC(=O)C2C3CC4CC(C3)CC2C4)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C21H32O2/c1-11-17-9-16(21(17,2)3)10-18(11)23-20(22)19-14-5-12-4-13(7-14)8-15(19)6-12/h11-19H,4-10H2,1-3H3/t11-,12?,13?,14?,15?,16+,17-,18-,19?/m0/s1 |
| InChIKey | UCXNCFDKJXWGMG-QNKWNLTOSA-N |
| XLogP | 4.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |