C20H22N2O2 — CID 11034628
(2Z)-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1,2-diphenylethanone (PubChem CID 11034628) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (2Z)-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1,2-diphenylethanone.
| Compound Name | (2Z)-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1,2-diphenylethanone |
|---|---|
| PubChem CID | 11034628 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (2Z)-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1,2-diphenylethanone |
| SMILES | COC[C@@H]1CCCN1/N=C(\C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O2/c1-24-15-18-13-8-14-22(18)21-19(16-9-4-2-5-10-16)20(23)17-11-6-3-7-12-17/h2-7,9-12,18H,8,13-15H2,1H3/b21-19-/t18-/m0/s1 |
| InChIKey | ZCKSGIYTBMKOTJ-GRNWLOBZSA-N |
| XLogP | 3.38 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|