C20H27N3O5 — CID 110346317
1-(2-methoxyethyl)-4-[4-(2-phenoxyacetyl)piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 110346317) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-[4-(2-phenoxyacetyl)piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(2-methoxyethyl)-4-[4-(2-phenoxyacetyl)piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 110346317 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 1-(2-methoxyethyl)-4-[4-(2-phenoxyacetyl)piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | COCCN1CC(C(=O)N2CCN(C(=O)COc3ccccc3)CC2)CC1=O |
| InChI | InChI=1S/C20H27N3O5/c1-27-12-11-23-14-16(13-18(23)24)20(26)22-9-7-21(8-10-22)19(25)15-28-17-5-3-2-4-6-17/h2-6,16H,7-15H2,1H3 |
| InChIKey | GJRCOFIGJQJZIZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |