C16H24N4O2 — CID 110348022
1,1-dimethyl-3-[(2S)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl]urea (PubChem CID 110348022) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(2S)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl]urea.
| Compound Name | 1,1-dimethyl-3-[(2S)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 110348022 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1,1-dimethyl-3-[(2S)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl]urea |
| SMILES | C[C@H](NC(=O)N(C)C)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N4O2/c1-13(17-16(22)18(2)3)15(21)20-11-9-19(10-12-20)14-7-5-4-6-8-14/h4-8,13H,9-12H2,1-3H3,(H,17,22)/t13-/m0/s1 |
| InChIKey | CTVZNPXBDIKGHO-ZDUSSCGKSA-N |
| XLogP | 0.99 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |