C16H30O5Si — CID 11034901
(E)-3-[(3aR,5R,6S,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-en-1-ol (PubChem CID 11034901) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is (E)-3-[(3aR,5R,6S,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(3aR,5R,6S,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 11034901 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (E)-3-[(3aR,5R,6S,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-en-1-ol |
| SMILES | CC1(C)O[C@H]2O[C@H](/C=C/CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C16H30O5Si/c1-15(2,3)22(6,7)21-12-11(9-8-10-17)18-14-13(12)19-16(4,5)20-14/h8-9,11-14,17H,10H2,1-7H3/b9-8+/t11-,12+,13-,14-/m1/s1 |
| InChIKey | NUOBJHDEGFDVBF-PCUPICAESA-N |
| XLogP | 2.80 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|