C21H25N3O2S — CID 110349753
2-(2-methylphenyl)-2-[4-[(3-methylphenyl)methylsulfonyl]piperazin-1-yl]acetonitrile (PubChem CID 110349753) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is 2-(2-methylphenyl)-2-[4-[(3-methylphenyl)methylsulfonyl]piperazin-1-yl]acetonitrile.
| Compound Name | 2-(2-methylphenyl)-2-[4-[(3-methylphenyl)methylsulfonyl]piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 110349753 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-(2-methylphenyl)-2-[4-[(3-methylphenyl)methylsulfonyl]piperazin-1-yl]acetonitrile |
| SMILES | Cc1cccc(CS(=O)(=O)N2CCN(C(C#N)c3ccccc3C)CC2)c1 |
| InChI | InChI=1S/C21H25N3O2S/c1-17-6-5-8-19(14-17)16-27(25,26)24-12-10-23(11-13-24)21(15-22)20-9-4-3-7-18(20)2/h3-9,14,21H,10-13,16H2,1-2H3 |
| InChIKey | PMFCLNAFQQZZPS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |