C22H26N4O — CID 110350242
2-[4-(dimethylamino)phenyl]-2-[4-(3-methylbenzoyl)piperazin-1-yl]acetonitrile (PubChem CID 110350242) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-2-[4-(3-methylbenzoyl)piperazin-1-yl]acetonitrile.
| Compound Name | 2-[4-(dimethylamino)phenyl]-2-[4-(3-methylbenzoyl)piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 110350242 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-2-[4-(3-methylbenzoyl)piperazin-1-yl]acetonitrile |
| SMILES | Cc1cccc(C(=O)N2CCN(C(C#N)c3ccc(N(C)C)cc3)CC2)c1 |
| InChI | InChI=1S/C22H26N4O/c1-17-5-4-6-19(15-17)22(27)26-13-11-25(12-14-26)21(16-23)18-7-9-20(10-8-18)24(2)3/h4-10,15,21H,11-14H2,1-3H3 |
| InChIKey | BQFZHUHXTVFGEL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|