About ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate
ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate (PubChem CID 11035034) has the molecular formula C20H17NO4
and a molecular weight of 335.36 g/mol. Its IUPAC name is ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate |
| PubChem CID | 11035034 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N(Cc2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C20H17NO4/c1-2-25-20(24)16-17(15-11-7-4-8-12-15)21(19(23)18(16)22)13-14-9-5-3-6-10-14/h3-12H,2,13H2,1H3 |
| InChIKey | JDQQDSCLYLPTIE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate?
The IUPAC name of ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate (CID 11035034) is ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate.
What is the SMILES notation for ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate?
The canonical SMILES for ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate is CCOC(=O)C1=C(c2ccccc2)N(Cc2ccccc2)C(=O)C1=O.
What is the InChIKey of ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate?
The InChIKey is JDQQDSCLYLPTIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO4/c1-2-25-20(24)16-17(15-11-7-4-8-12-15)21(19(23)18(16)22)13-14-9-5-3-6-10-14/h3-12H,2,13H2,1H3.
What are the key properties of ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate?
ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate has a molecular weight of 335.36 g/mol, XLogP of 2.57, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-benzyl-4,5-dioxo-2-phenylpyrrole-3-carboxylate is sourced from PubChem (CID 11035034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).