About 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline
4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline (PubChem CID 11035049) has the molecular formula C21H25N3O
and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline.
Molecular Properties
| Compound Name | 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline |
| PubChem CID | 11035049 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline |
| SMILES | Cn1c2c(c3ccccc31)CN(CCCOc1ccc(N)cc1)CC2 |
| InChI | InChI=1S/C21H25N3O/c1-23-20-6-3-2-5-18(20)19-15-24(13-11-21(19)23)12-4-14-25-17-9-7-16(22)8-10-17/h2-3,5-10H,4,11-15,22H2,1H3 |
| InChIKey | QEOFCXKCKVVHLM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline?
The IUPAC name of 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline (CID 11035049) is 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline.
What is the SMILES notation for 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline?
The canonical SMILES for 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline is Cn1c2c(c3ccccc31)CN(CCCOc1ccc(N)cc1)CC2.
What is the InChIKey of 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline?
The InChIKey is QEOFCXKCKVVHLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O/c1-23-20-6-3-2-5-18(20)19-15-24(13-11-21(19)23)12-4-14-25-17-9-7-16(22)8-10-17/h2-3,5-10H,4,11-15,22H2,1H3.
What are the key properties of 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline?
4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline has a molecular weight of 335.45 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)propoxy]aniline is sourced from PubChem (CID 11035049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).