C20H32O4 — CID 11035083
(2R)-2-[(1S,4E,6E,9S,10E,14S)-9-hydroxy-4,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-7-yl]propane-1,2-diol (PubChem CID 11035083) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (2R)-2-[(1S,4E,6E,9S,10E,14S)-9-hydroxy-4,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-7-yl]propane-1,2-diol.
| Compound Name | (2R)-2-[(1S,4E,6E,9S,10E,14S)-9-hydroxy-4,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-7-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 11035083 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (2R)-2-[(1S,4E,6E,9S,10E,14S)-9-hydroxy-4,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-7-yl]propane-1,2-diol |
| SMILES | C/C1=C\C=C(\[C@@](C)(O)CO)C[C@H](O)/C(C)=C/CC[C@]2(C)O[C@H]2CC1 |
| InChI | InChI=1S/C20H32O4/c1-14-7-9-16(19(3,23)13-21)12-17(22)15(2)6-5-11-20(4)18(24-20)10-8-14/h6-7,9,17-18,21-23H,5,8,10-13H2,1-4H3/b14-7+,15-6+,16-9+/t17-,18-,19-,20-/m0/s1 |
| InChIKey | NWBHMZVDIALTDH-AQCNIGGLSA-N |
| XLogP | 3.03 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|