C20H32O4 — CID 11035084
(1S,4R,7R,8R,11S)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,10-dioxatricyclo[5.3.1.04,11]undecane-3,9-diol (PubChem CID 11035084) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1S,4R,7R,8R,11S)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,10-dioxatricyclo[5.3.1.04,11]undecane-3,9-diol.
| Compound Name | (1S,4R,7R,8R,11S)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,10-dioxatricyclo[5.3.1.04,11]undecane-3,9-diol |
|---|---|
| PubChem CID | 11035084 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1S,4R,7R,8R,11S)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,10-dioxatricyclo[5.3.1.04,11]undecane-3,9-diol |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@H]1C(O)O[C@@H]2OC(O)[C@@H]3CC[C@H]1[C@H]23 |
| InChI | InChI=1S/C20H32O4/c1-12(2)6-4-7-13(3)8-5-9-15-14-10-11-16-17(14)20(23-18(15)21)24-19(16)22/h6,8,14-22H,4-5,7,9-11H2,1-3H3/b13-8+/t14-,15-,16-,17+,18?,19?,20-/m1/s1 |
| InChIKey | FGMCHIORPBCHGW-WOZRIONCSA-N |
| XLogP | 3.74 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|