C18H33NO3Si — CID 11035189
(7R,8R,8aS)-8-(3-ethyloxiran-2-yl)-7-triethylsilyloxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 11035189) has the molecular formula C18H33NO3Si and a molecular weight of 339.55 g/mol. Its IUPAC name is (7R,8R,8aS)-8-(3-ethyloxiran-2-yl)-7-triethylsilyloxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (7R,8R,8aS)-8-(3-ethyloxiran-2-yl)-7-triethylsilyloxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 11035189 |
| Molecular Formula | C18H33NO3Si |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (7R,8R,8aS)-8-(3-ethyloxiran-2-yl)-7-triethylsilyloxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CCC1OC1[C@@H]1[C@H](O[Si](CC)(CC)CC)CCN2C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C18H33NO3Si/c1-5-14-18(21-14)17-13-9-10-16(20)19(13)12-11-15(17)22-23(6-2,7-3)8-4/h13-15,17-18H,5-12H2,1-4H3/t13-,14?,15+,17-,18?/m0/s1 |
| InChIKey | VWYHNJPKCOMSRI-NAQURFAESA-N |
| XLogP | 3.57 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|