C16H23N3O5S — CID 110352396
N-[4-(3-methylmorpholin-4-yl)sulfonylphenyl]morpholine-4-carboxamide (PubChem CID 110352396) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is N-[4-(3-methylmorpholin-4-yl)sulfonylphenyl]morpholine-4-carboxamide.
| Compound Name | N-[4-(3-methylmorpholin-4-yl)sulfonylphenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 110352396 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-[4-(3-methylmorpholin-4-yl)sulfonylphenyl]morpholine-4-carboxamide |
| SMILES | CC1COCCN1S(=O)(=O)c1ccc(NC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H23N3O5S/c1-13-12-24-11-8-19(13)25(21,22)15-4-2-14(3-5-15)17-16(20)18-6-9-23-10-7-18/h2-5,13H,6-12H2,1H3,(H,17,20) |
| InChIKey | XLUKVKDIVNOESW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |