C20H24O5 — CID 11035332
methyl (1S,2R,3R,7S,9S,11S)-3-ethenyl-9-methoxy-10-oxo-2-prop-2-enyl-8-oxatetracyclo[7.4.0.02,7.03,11]tridec-12-ene-13-carboxylate (PubChem CID 11035332) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is methyl (1S,2R,3R,7S,9S,11S)-3-ethenyl-9-methoxy-10-oxo-2-prop-2-enyl-8-oxatetracyclo[7.4.0.02,7.03,11]tridec-12-ene-13-carboxylate.
| Compound Name | methyl (1S,2R,3R,7S,9S,11S)-3-ethenyl-9-methoxy-10-oxo-2-prop-2-enyl-8-oxatetracyclo[7.4.0.02,7.03,11]tridec-12-ene-13-carboxylate |
|---|---|
| PubChem CID | 11035332 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | methyl (1S,2R,3R,7S,9S,11S)-3-ethenyl-9-methoxy-10-oxo-2-prop-2-enyl-8-oxatetracyclo[7.4.0.02,7.03,11]tridec-12-ene-13-carboxylate |
| SMILES | C=CC[C@]12[C@@H]3CCC[C@@]1(C=C)[C@@H]1C=C(C(=O)OC)[C@H]2[C@](OC)(O3)C1=O |
| InChI | InChI=1S/C20H24O5/c1-5-9-19-14-8-7-10-18(19,6-2)13-11-12(17(22)23-3)15(19)20(24-4,25-14)16(13)21/h5-6,11,13-15H,1-2,7-10H2,3-4H3/t13-,14+,15-,18+,19-,20+/m1/s1 |
| InChIKey | IXPURJRSUBVLHX-UGCNJCKESA-N |
| XLogP | 2.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|