C20H29FN2O3 — CID 110353983
2-(4-fluorophenyl)-N-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]butanamide (PubChem CID 110353983) has the molecular formula C20H29FN2O3 and a molecular weight of 364.46 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]butanamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]butanamide |
|---|---|
| PubChem CID | 110353983 |
| Molecular Formula | C20H29FN2O3 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]butanamide |
| SMILES | CCC(C(=O)N[C@@H](CC(C)C)C(=O)N1CCOCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H29FN2O3/c1-4-17(15-5-7-16(21)8-6-15)19(24)22-18(13-14(2)3)20(25)23-9-11-26-12-10-23/h5-8,14,17-18H,4,9-13H2,1-3H3,(H,22,24)/t17?,18-/m0/s1 |
| InChIKey | LAFSAXVNMNJVDB-ZVAWYAOSSA-N |
| XLogP | 2.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |