C22H25FN2O2 — CID 110354245
N-(1-acetyl-2,3-dihydroindol-6-yl)-3-(4-fluorophenyl)hexanamide (PubChem CID 110354245) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-6-yl)-3-(4-fluorophenyl)hexanamide.
| Compound Name | N-(1-acetyl-2,3-dihydroindol-6-yl)-3-(4-fluorophenyl)hexanamide |
|---|---|
| PubChem CID | 110354245 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-6-yl)-3-(4-fluorophenyl)hexanamide |
| SMILES | CCCC(CC(=O)Nc1ccc2c(c1)N(C(C)=O)CC2)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN2O2/c1-3-4-18(16-5-8-19(23)9-6-16)13-22(27)24-20-10-7-17-11-12-25(15(2)26)21(17)14-20/h5-10,14,18H,3-4,11-13H2,1-2H3,(H,24,27) |
| InChIKey | FNEOGGOUGVTCGF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |