C21H20FN3O3 — CID 110354604
N-[2-[[2-[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]acetyl]amino]ethyl]benzamide (PubChem CID 110354604) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is N-[2-[[2-[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]acetyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[2-[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 110354604 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-[2-[[2-[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]acetyl]amino]ethyl]benzamide |
| SMILES | Cc1oc(-c2ccccc2F)nc1CC(=O)NCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20FN3O3/c1-14-18(25-21(28-14)16-9-5-6-10-17(16)22)13-19(26)23-11-12-24-20(27)15-7-3-2-4-8-15/h2-10H,11-13H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | MUNSFRMNFZCBMX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|