C14H27NO7Si — CID 11035476
[(3aS,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl] nitrate (PubChem CID 11035476) has the molecular formula C14H27NO7Si and a molecular weight of 349.46 g/mol. Its IUPAC name is [(3aS,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl] nitrate.
| Compound Name | [(3aS,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl] nitrate |
|---|---|
| PubChem CID | 11035476 |
| Molecular Formula | C14H27NO7Si |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | [(3aS,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl] nitrate |
| SMILES | CC1(C)O[C@H]2[C@H](COC(O[N+](=O)[O-])[C@@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C14H27NO7Si/c1-13(2,3)23(6,7)22-11-10-9(19-14(4,5)20-10)8-18-12(11)21-15(16)17/h9-12H,8H2,1-7H3/t9-,10-,11+,12?/m0/s1 |
| InChIKey | OFJPWMWRCWVJIY-WSMDXJOWSA-N |
| XLogP | 2.46 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|