About (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone
(7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone (PubChem CID 11035535) has the molecular formula C22H25NO3
and a molecular weight of 351.45 g/mol. Its IUPAC name is (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone |
| PubChem CID | 11035535 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone |
| SMILES | CCCCCOc1cc2c(cc1OC)C(C(=O)c1ccccc1)=NCC2 |
| InChI | InChI=1S/C22H25NO3/c1-3-4-8-13-26-20-14-17-11-12-23-21(18(17)15-19(20)25-2)22(24)16-9-6-5-7-10-16/h5-7,9-10,14-15H,3-4,8,11-13H2,1-2H3 |
| InChIKey | SQZGLNXEOCABGZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone?
The IUPAC name of (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone (CID 11035535) is (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone.
What is the SMILES notation for (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone?
The canonical SMILES for (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone is CCCCCOc1cc2c(cc1OC)C(C(=O)c1ccccc1)=NCC2.
What is the InChIKey of (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone?
The InChIKey is SQZGLNXEOCABGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO3/c1-3-4-8-13-26-20-14-17-11-12-23-21(18(17)15-19(20)25-2)22(24)16-9-6-5-7-10-16/h5-7,9-10,14-15H,3-4,8,11-13H2,1-2H3.
What are the key properties of (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone?
(7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone has a molecular weight of 351.45 g/mol, XLogP of 4.49, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methoxy-6-pentoxy-3,4-dihydroisoquinolin-1-yl)-phenylmethanone is sourced from PubChem (CID 11035535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).