C22H26FN3 — CID 11035539
N-[2-(4-fluorophenyl)quinolin-4-yl]-N',N'-dimethylpentane-1,5-diamine (PubChem CID 11035539) has the molecular formula C22H26FN3 and a molecular weight of 351.47 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)quinolin-4-yl]-N',N'-dimethylpentane-1,5-diamine.
| Compound Name | N-[2-(4-fluorophenyl)quinolin-4-yl]-N',N'-dimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 11035539 |
| Molecular Formula | C22H26FN3 |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | N-[2-(4-fluorophenyl)quinolin-4-yl]-N',N'-dimethylpentane-1,5-diamine |
| SMILES | CN(C)CCCCCNc1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C22H26FN3/c1-26(2)15-7-3-6-14-24-22-16-21(17-10-12-18(23)13-11-17)25-20-9-5-4-8-19(20)22/h4-5,8-13,16H,3,6-7,14-15H2,1-2H3,(H,24,25) |
| InChIKey | YCWPSQNBVDABCW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|