C20H17ClN2O3 — CID 110356637
[2-(3-chlorophenyl)morpholin-4-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone (PubChem CID 110356637) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is [2-(3-chlorophenyl)morpholin-4-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone.
| Compound Name | [2-(3-chlorophenyl)morpholin-4-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 110356637 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [2-(3-chlorophenyl)morpholin-4-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)on1)N1CCOC(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H17ClN2O3/c21-16-8-4-7-15(11-16)19-13-23(9-10-25-19)20(24)17-12-18(26-22-17)14-5-2-1-3-6-14/h1-8,11-12,19H,9-10,13H2 |
| InChIKey | JGIPEUPUTYQTJL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |