About N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide
N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide (PubChem CID 110356809) has the molecular formula C18H23N3O3
and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide |
| PubChem CID | 110356809 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide |
| SMILES | CC(=O)NCCCCNC(=O)c1cc2cc(C)cc(C)c2[nH]c1=O |
| InChI | InChI=1S/C18H23N3O3/c1-11-8-12(2)16-14(9-11)10-15(18(24)21-16)17(23)20-7-5-4-6-19-13(3)22/h8-10H,4-7H2,1-3H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | MHXFEOQWEBCPMD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide?
The IUPAC name of N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide (CID 110356809) is N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide.
What is the SMILES notation for N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide?
The canonical SMILES for N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide is CC(=O)NCCCCNC(=O)c1cc2cc(C)cc(C)c2[nH]c1=O.
What is the InChIKey of N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide?
The InChIKey is MHXFEOQWEBCPMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O3/c1-11-8-12(2)16-14(9-11)10-15(18(24)21-16)17(23)20-7-5-4-6-19-13(3)22/h8-10H,4-7H2,1-3H3,(H,19,22)(H,20,23)(H,21,24).
What are the key properties of N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide?
N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide has a molecular weight of 329.40 g/mol, XLogP of 1.79, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-acetamidobutyl)-6,8-dimethyl-2-oxo-1H-quinoline-3-carboxamide is sourced from PubChem (CID 110356809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).