C18H16BrNO2 — CID 110357643
[1-(4-bromobenzoyl)pyrrolidin-2-yl]-phenylmethanone (PubChem CID 110357643) has the molecular formula C18H16BrNO2 and a molecular weight of 358.24 g/mol. Its IUPAC name is [1-(4-bromobenzoyl)pyrrolidin-2-yl]-phenylmethanone.
| Compound Name | [1-(4-bromobenzoyl)pyrrolidin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 110357643 |
| Molecular Formula | C18H16BrNO2 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | [1-(4-bromobenzoyl)pyrrolidin-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1CCCN1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H16BrNO2/c19-15-10-8-14(9-11-15)18(22)20-12-4-7-16(20)17(21)13-5-2-1-3-6-13/h1-3,5-6,8-11,16H,4,7,12H2 |
| InChIKey | RZIMJDHFEWKOBM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |