About benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate
benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 1103586) has the molecular formula C22H21N3O3S
and a molecular weight of 407.50 g/mol. Its IUPAC name is benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate |
| PubChem CID | 1103586 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H21N3O3S/c26-20(24-21-23-18(15-29-21)17-10-5-2-6-11-17)19-12-7-13-25(19)22(27)28-14-16-8-3-1-4-9-16/h1-6,8-11,15,19H,7,12-14H2,(H,23,24,26)/t19-/m0/s1 |
| InChIKey | VCYWPDBDGYFVMY-IBGZPJMESA-N |
| XLogP | 4.55 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate?
The IUPAC name of benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate (CID 1103586) is benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate?
The canonical SMILES for benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate is O=C(Nc1nc(-c2ccccc2)cs1)[C@@H]1CCCN1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate?
The InChIKey is VCYWPDBDGYFVMY-IBGZPJMESA-N. The full InChI is InChI=1S/C22H21N3O3S/c26-20(24-21-23-18(15-29-21)17-10-5-2-6-11-17)19-12-7-13-25(19)22(27)28-14-16-8-3-1-4-9-16/h1-6,8-11,15,19H,7,12-14H2,(H,23,24,26)/t19-/m0/s1.
What are the key properties of benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate?
benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate has a molecular weight of 407.50 g/mol, XLogP of 4.55, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 1103586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).