C18H19ClFNO3S — CID 110358899
4-(3-chlorophenoxy)-1-(4-fluoro-3-methylphenyl)sulfonylpiperidine (PubChem CID 110358899) has the molecular formula C18H19ClFNO3S and a molecular weight of 383.87 g/mol. Its IUPAC name is 4-(3-chlorophenoxy)-1-(4-fluoro-3-methylphenyl)sulfonylpiperidine.
| Compound Name | 4-(3-chlorophenoxy)-1-(4-fluoro-3-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 110358899 |
| Molecular Formula | C18H19ClFNO3S |
| Molecular Weight | 383.87 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 4-(3-chlorophenoxy)-1-(4-fluoro-3-methylphenyl)sulfonylpiperidine |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(Oc3cccc(Cl)c3)CC2)ccc1F |
| InChI | InChI=1S/C18H19ClFNO3S/c1-13-11-17(5-6-18(13)20)25(22,23)21-9-7-15(8-10-21)24-16-4-2-3-14(19)12-16/h2-6,11-12,15H,7-10H2,1H3 |
| InChIKey | WIDZZJJZUQWUQN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.87 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |