C22H40O2Si — CID 11035894
tert-butyl-[(2R)-2-[(1S,2R,4S,8E)-8-(methoxymethylidene)-4-methyl-2-bicyclo[2.2.2]oct-5-enyl]-3-methylbutoxy]-dimethylsilane (PubChem CID 11035894) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-[(1S,2R,4S,8E)-8-(methoxymethylidene)-4-methyl-2-bicyclo[2.2.2]oct-5-enyl]-3-methylbutoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-2-[(1S,2R,4S,8E)-8-(methoxymethylidene)-4-methyl-2-bicyclo[2.2.2]oct-5-enyl]-3-methylbutoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11035894 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | tert-butyl-[(2R)-2-[(1S,2R,4S,8E)-8-(methoxymethylidene)-4-methyl-2-bicyclo[2.2.2]oct-5-enyl]-3-methylbutoxy]-dimethylsilane |
| SMILES | CO/C=C1\C[C@H]2C=C[C@]1(C)C[C@H]2[C@H](CO[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C22H40O2Si/c1-16(2)20(15-24-25(8,9)21(3,4)5)19-13-22(6)11-10-17(19)12-18(22)14-23-7/h10-11,14,16-17,19-20H,12-13,15H2,1-9H3/b18-14+/t17-,19-,20-,22-/m1/s1 |
| InChIKey | LEYMAAGWTLBHJW-XEZLMHAASA-N |
| XLogP | 6.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|