C24H30O4 — CID 1103590
9-(4-methoxycyclohexa-1,3-dien-1-yl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 1103590) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 9-(4-methoxycyclohexa-1,3-dien-1-yl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-(4-methoxycyclohexa-1,3-dien-1-yl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 1103590 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 9-(4-methoxycyclohexa-1,3-dien-1-yl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | COC1=CC=C(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)CC1 |
| InChI | InChI=1S/C24H30O4/c1-23(2)10-16(25)21-18(12-23)28-19-13-24(3,4)11-17(26)22(19)20(21)14-6-8-15(27-5)9-7-14/h6,8,20H,7,9-13H2,1-5H3 |
| InChIKey | MSRXJIQTOGJPIM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |