C21H24ClN3O2 — CID 110359222
N-[4-[2-[4-(3-chlorobenzoyl)piperazin-1-yl]ethyl]phenyl]acetamide (PubChem CID 110359222) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is N-[4-[2-[4-(3-chlorobenzoyl)piperazin-1-yl]ethyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[4-(3-chlorobenzoyl)piperazin-1-yl]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 110359222 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[4-[2-[4-(3-chlorobenzoyl)piperazin-1-yl]ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CCN2CCN(C(=O)c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C21H24ClN3O2/c1-16(26)23-20-7-5-17(6-8-20)9-10-24-11-13-25(14-12-24)21(27)18-3-2-4-19(22)15-18/h2-8,15H,9-14H2,1H3,(H,23,26) |
| InChIKey | OURVIAOEUIEOIK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |