About CID 11036068
CID 11036068 (PubChem CID 11036068) has the molecular formula C24H23N2O2
and a molecular weight of 371.46 g/mol.
Molecular Properties
| Compound Name | CID 11036068 |
| PubChem CID | 11036068 |
| Molecular Formula | C24H23N2O2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | — |
| SMILES | CC(C)Oc1cccc2c1N([O])C(C)(c1ccccc1)/C2=N/c1ccccc1 |
| InChI | InChI=1S/C24H23N2O2/c1-17(2)28-21-16-10-15-20-22(21)26(27)24(3,18-11-6-4-7-12-18)23(20)25-19-13-8-5-9-14-19/h4-17H,1-3H3/b25-23+ |
| InChIKey | RTHUGWSFFYTVNK-WJTDDFOZSA-N |
| XLogP | 5.68 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 11036068 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11036068?
The IUPAC name of CID 11036068 (CID 11036068) is not available.
What is the SMILES notation for CID 11036068?
The canonical SMILES for CID 11036068 is CC(C)Oc1cccc2c1N([O])C(C)(c1ccccc1)/C2=N/c1ccccc1.
What is the InChIKey of CID 11036068?
The InChIKey is RTHUGWSFFYTVNK-WJTDDFOZSA-N. The full InChI is InChI=1S/C24H23N2O2/c1-17(2)28-21-16-10-15-20-22(21)26(27)24(3,18-11-6-4-7-12-18)23(20)25-19-13-8-5-9-14-19/h4-17H,1-3H3/b25-23+.
What are the key properties of CID 11036068?
CID 11036068 has a molecular weight of 371.46 g/mol, XLogP of 5.68, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11036068 is sourced from PubChem (CID 11036068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).