C19H36O5Si — CID 11036091
2-[(3aR,5R,6R,6aR)-2,2,6-trimethyl-6-prop-2-enoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 11036091) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is 2-[(3aR,5R,6R,6aR)-2,2,6-trimethyl-6-prop-2-enoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[(3aR,5R,6R,6aR)-2,2,6-trimethyl-6-prop-2-enoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11036091 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-[(3aR,5R,6R,6aR)-2,2,6-trimethyl-6-prop-2-enoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | C=CCO[C@]1(C)[C@@H](CCO[Si](C)(C)C(C)(C)C)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C19H36O5Si/c1-10-12-20-19(7)14(11-13-21-25(8,9)17(2,3)4)22-16-15(19)23-18(5,6)24-16/h10,14-16H,1,11-13H2,2-9H3/t14-,15+,16-,19-/m1/s1 |
| InChIKey | XTIQKKDFVXLPQY-YYAJDYIMSA-N |
| XLogP | 4.24 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|