C17H16ClN3O4S — CID 110361418
6-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 110361418) has the molecular formula C17H16ClN3O4S and a molecular weight of 393.85 g/mol. Its IUPAC name is 6-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110361418 |
| Molecular Formula | C17H16ClN3O4S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 6-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(N3CCN(S(=O)(=O)c4cccc(Cl)c4)CC3)cc2o1 |
| InChI | InChI=1S/C17H16ClN3O4S/c18-12-2-1-3-14(10-12)26(23,24)21-8-6-20(7-9-21)13-4-5-15-16(11-13)25-17(22)19-15/h1-5,10-11H,6-9H2,(H,19,22) |
| InChIKey | LRWOPHJMZVFURW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |