C20H15ClN6 — CID 11036145
4-(4-chlorophenyl)-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 11036145) has the molecular formula C20H15ClN6 and a molecular weight of 374.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-(4-chlorophenyl)-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 11036145 |
| Molecular Formula | C20H15ClN6 |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-(4-chlorophenyl)-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Clc1ccc(-c2nc3c4cnn(CCc5ccccc5)c4ncn3n2)cc1 |
| InChI | InChI=1S/C20H15ClN6/c21-16-8-6-15(7-9-16)18-24-20-17-12-23-26(19(17)22-13-27(20)25-18)11-10-14-4-2-1-3-5-14/h1-9,12-13H,10-11H2 |
| InChIKey | AXBHLYBOAWHFIY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |