C15H12BrF4NO — CID 11036219
3-bromo-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]aniline (PubChem CID 11036219) has the molecular formula C15H12BrF4NO and a molecular weight of 378.16 g/mol. Its IUPAC name is 3-bromo-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]aniline.
| Compound Name | 3-bromo-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 11036219 |
| Molecular Formula | C15H12BrF4NO |
| Molecular Weight | 378.16 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 3-bromo-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]aniline |
| SMILES | FC(F)C(F)(F)Oc1cccc(CNc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C15H12BrF4NO/c16-11-4-2-5-12(8-11)21-9-10-3-1-6-13(7-10)22-15(19,20)14(17)18/h1-8,14,21H,9H2 |
| InChIKey | JFFTZAKGWGBTPV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.16 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|