About dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate
dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate (PubChem CID 11036237) has the molecular formula C16H34O6Si2
and a molecular weight of 378.61 g/mol. Its IUPAC name is dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate.
Molecular Properties
| Compound Name | dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate |
| PubChem CID | 11036237 |
| Molecular Formula | C16H34O6Si2 |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate |
| SMILES | CC(C)OC(=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C16H34O6Si2/c1-11(2)19-15(17)13(21-23(5,6)7)14(22-24(8,9)10)16(18)20-12(3)4/h11-14H,1-10H3/t13-,14-/m1/s1 |
| InChIKey | WTAZEIUCUCCYIA-ZIAGYGMSSA-N |
| XLogP | 3.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate?
The IUPAC name of dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate (CID 11036237) is dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate.
What is the SMILES notation for dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate?
The canonical SMILES for dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate is CC(C)OC(=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)OC(C)C.
What is the InChIKey of dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate?
The InChIKey is WTAZEIUCUCCYIA-ZIAGYGMSSA-N. The full InChI is InChI=1S/C16H34O6Si2/c1-11(2)19-15(17)13(21-23(5,6)7)14(22-24(8,9)10)16(18)20-12(3)4/h11-14H,1-10H3/t13-,14-/m1/s1.
What are the key properties of dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate?
dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate has a molecular weight of 378.61 g/mol, XLogP of 3.33, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl (2R,3R)-2,3-bis(trimethylsilyloxy)butanedioate is sourced from PubChem (CID 11036237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).