C18H28O7Si — CID 11036412
[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate (PubChem CID 11036412) has the molecular formula C18H28O7Si and a molecular weight of 384.50 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11036412 |
| Molecular Formula | C18H28O7Si |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate |
| SMILES | C[Si](C)(C)CCO[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H28O7Si/c1-26(2,3)10-9-23-18-16(21)15(20)14(19)13(25-18)11-24-17(22)12-7-5-4-6-8-12/h4-8,13-16,18-21H,9-11H2,1-3H3/t13-,14+,15+,16-,18-/m1/s1 |
| InChIKey | GTGAOZZXXNKPPW-QYXWGXCQSA-N |
| XLogP | 1.01 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|