C18H28N2O2 — CID 110364135
N,N-diethyl-2-(4-propan-2-ylphenyl)morpholine-4-carboxamide (PubChem CID 110364135) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is N,N-diethyl-2-(4-propan-2-ylphenyl)morpholine-4-carboxamide.
| Compound Name | N,N-diethyl-2-(4-propan-2-ylphenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 110364135 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N,N-diethyl-2-(4-propan-2-ylphenyl)morpholine-4-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCOC(c2ccc(C(C)C)cc2)C1 |
| InChI | InChI=1S/C18H28N2O2/c1-5-19(6-2)18(21)20-11-12-22-17(13-20)16-9-7-15(8-10-16)14(3)4/h7-10,14,17H,5-6,11-13H2,1-4H3 |
| InChIKey | RFDXNBSBZIJVAM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |