C21H24N2O3 — CID 110365049
[4-(3,4-dimethylbenzoyl)piperazin-1-yl]-(3-methoxyphenyl)methanone (PubChem CID 110365049) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [4-(3,4-dimethylbenzoyl)piperazin-1-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [4-(3,4-dimethylbenzoyl)piperazin-1-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 110365049 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [4-(3,4-dimethylbenzoyl)piperazin-1-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCN(C(=O)c3ccc(C)c(C)c3)CC2)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-15-7-8-18(13-16(15)2)21(25)23-11-9-22(10-12-23)20(24)17-5-4-6-19(14-17)26-3/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | GAPWIGJTAMIFDO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |