About methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate
methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate (PubChem CID 11036560) has the molecular formula C21H18N4O4
and a molecular weight of 390.40 g/mol. Its IUPAC name is methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate |
| PubChem CID | 11036560 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate |
| SMILES | COC(=O)/C=C/Cn1c(=O)c2c(nc3ccccn32)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C21H18N4O4/c1-29-17(26)11-7-13-24-20(27)18-19(22-16-10-5-6-12-23(16)18)25(21(24)28)14-15-8-3-2-4-9-15/h2-12H,13-14H2,1H3/b11-7+ |
| InChIKey | QMVIRIRZLGPOAA-YRNVUSSQSA-N |
| XLogP | 1.59 |
| TPSA | 87.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate?
The IUPAC name of methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate (CID 11036560) is methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate.
What is the SMILES notation for methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate?
The canonical SMILES for methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate is COC(=O)/C=C/Cn1c(=O)c2c(nc3ccccn32)n(Cc2ccccc2)c1=O.
What is the InChIKey of methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate?
The InChIKey is QMVIRIRZLGPOAA-YRNVUSSQSA-N. The full InChI is InChI=1S/C21H18N4O4/c1-29-17(26)11-7-13-24-20(27)18-19(22-16-10-5-6-12-23(16)18)25(21(24)28)14-15-8-3-2-4-9-15/h2-12H,13-14H2,1H3/b11-7+.
What are the key properties of methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate?
methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate has a molecular weight of 390.40 g/mol, XLogP of 1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-(1-benzyl-2,4-dioxopurino[7,8-a]pyridin-3-yl)but-2-enoate is sourced from PubChem (CID 11036560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).