C25H48OSi — CID 11036625
2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethoxy-tri(propan-2-yl)silane (PubChem CID 11036625) has the molecular formula C25H48OSi and a molecular weight of 392.74 g/mol. Its IUPAC name is 2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethoxy-tri(propan-2-yl)silane.
| Compound Name | 2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11036625 |
| Molecular Formula | C25H48OSi |
| Molecular Weight | 392.74 g/mol |
| Exact Mass | 392.35 |
| IUPAC Name | 2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethoxy-tri(propan-2-yl)silane |
| SMILES | CC1=CCC[C@@H]2[C@@](C)(CCO[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)CC[C@@]12C |
| InChI | InChI=1S/C25H48OSi/c1-18(2)27(19(3)4,20(5)6)26-17-16-25(10)22(8)14-15-24(9)21(7)12-11-13-23(24)25/h12,18-20,22-23H,11,13-17H2,1-10H3/t22-,23+,24+,25+/m1/s1 |
| InChIKey | CMBPLTUBLQHSRO-ROHNOIKCSA-N |
| XLogP | 8.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.74 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|